C22H32FN5O2 — CID 172590660
3-[3-fluoro-4-[4-[4-(methylamino)cyclohexyl]piperazin-1-yl]anilino]piperidine-2,6-dione (PubChem CID 172590660) has the molecular formula C22H32FN5O2 and a molecular weight of 417.53 g/mol. Its IUPAC name is 3-[3-fluoro-4-[4-[4-(methylamino)cyclohexyl]piperazin-1-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[3-fluoro-4-[4-[4-(methylamino)cyclohexyl]piperazin-1-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172590660 |
| Molecular Formula | C22H32FN5O2 |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 3-[3-fluoro-4-[4-[4-(methylamino)cyclohexyl]piperazin-1-yl]anilino]piperidine-2,6-dione |
| SMILES | CNC1CCC(N2CCN(c3ccc(NC4CCC(=O)NC4=O)cc3F)CC2)CC1 |
| InChI | InChI=1S/C22H32FN5O2/c1-24-15-2-5-17(6-3-15)27-10-12-28(13-11-27)20-8-4-16(14-18(20)23)25-19-7-9-21(29)26-22(19)30/h4,8,14-15,17,19,24-25H,2-3,5-7,9-13H2,1H3,(H,26,29,30) |
| InChIKey | IDLABUUJDPPVIK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|