C22H29FN4O4 — CID 172589741
4-[1-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperidin-4-yl]oxypiperidine-1-carbaldehyde (PubChem CID 172589741) has the molecular formula C22H29FN4O4 and a molecular weight of 432.50 g/mol. Its IUPAC name is 4-[1-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperidin-4-yl]oxypiperidine-1-carbaldehyde.
| Compound Name | 4-[1-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperidin-4-yl]oxypiperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 172589741 |
| Molecular Formula | C22H29FN4O4 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 4-[1-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]piperidin-4-yl]oxypiperidine-1-carbaldehyde |
| SMILES | O=CN1CCC(OC2CCN(c3ccc(NC4CCC(=O)NC4=O)cc3F)CC2)CC1 |
| InChI | InChI=1S/C22H29FN4O4/c23-18-13-15(24-19-2-4-21(29)25-22(19)30)1-3-20(18)27-11-7-17(8-12-27)31-16-5-9-26(14-28)10-6-16/h1,3,13-14,16-17,19,24H,2,4-12H2,(H,25,29,30) |
| InChIKey | WQCQDGVWULENPO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|