C21H29ClFN5O3 — CID 178082091
3-[3-fluoro-4-[4-(piperidine-4-carbonyl)piperazin-1-yl]anilino]piperidine-2,6-dione;hydrochloride (PubChem CID 178082091) has the molecular formula C21H29ClFN5O3 and a molecular weight of 453.95 g/mol. Its IUPAC name is 3-[3-fluoro-4-[4-(piperidine-4-carbonyl)piperazin-1-yl]anilino]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[3-fluoro-4-[4-(piperidine-4-carbonyl)piperazin-1-yl]anilino]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 178082091 |
| Molecular Formula | C21H29ClFN5O3 |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 3-[3-fluoro-4-[4-(piperidine-4-carbonyl)piperazin-1-yl]anilino]piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.O=C1CCC(Nc2ccc(N3CCN(C(=O)C4CCNCC4)CC3)c(F)c2)C(=O)N1 |
| InChI | InChI=1S/C21H28FN5O3.ClH/c22-16-13-15(24-17-2-4-19(28)25-20(17)29)1-3-18(16)26-9-11-27(12-10-26)21(30)14-5-7-23-8-6-14;/h1,3,13-14,17,23-24H,2,4-12H2,(H,25,28,29);1H |
| InChIKey | AEKXPRWTEZDWCA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|