C24H32FN5O4 — CID 166729573
4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]-N-(1-formylpiperidin-4-yl)-N-methylpiperidine-1-carboxamide (PubChem CID 166729573) has the molecular formula C24H32FN5O4 and a molecular weight of 473.55 g/mol. Its IUPAC name is 4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]-N-(1-formylpiperidin-4-yl)-N-methylpiperidine-1-carboxamide.
| Compound Name | 4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]-N-(1-formylpiperidin-4-yl)-N-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 166729573 |
| Molecular Formula | C24H32FN5O4 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]-N-(1-formylpiperidin-4-yl)-N-methylpiperidine-1-carboxamide |
| SMILES | CN(C(=O)N1CCC(c2ccc(NC3CCC(=O)NC3=O)cc2F)CC1)C1CCN(C=O)CC1 |
| InChI | InChI=1S/C24H32FN5O4/c1-28(18-8-10-29(15-31)11-9-18)24(34)30-12-6-16(7-13-30)19-3-2-17(14-20(19)25)26-21-4-5-22(32)27-23(21)33/h2-3,14-16,18,21,26H,4-13H2,1H3,(H,27,32,33) |
| InChIKey | RLVRJNOOYIRMQN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|