C20H32FN3 — CID 70912989
1-[1-(4-ethyl-2-fluorophenyl)piperidin-4-yl]-4-propan-2-ylpiperazine (PubChem CID 70912989) has the molecular formula C20H32FN3 and a molecular weight of 333.50 g/mol. Its IUPAC name is 1-[1-(4-ethyl-2-fluorophenyl)piperidin-4-yl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[1-(4-ethyl-2-fluorophenyl)piperidin-4-yl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 70912989 |
| Molecular Formula | C20H32FN3 |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.26 |
| IUPAC Name | 1-[1-(4-ethyl-2-fluorophenyl)piperidin-4-yl]-4-propan-2-ylpiperazine |
| SMILES | CCc1ccc(N2CCC(N3CCN(C(C)C)CC3)CC2)c(F)c1 |
| InChI | InChI=1S/C20H32FN3/c1-4-17-5-6-20(19(21)15-17)24-9-7-18(8-10-24)23-13-11-22(12-14-23)16(2)3/h5-6,15-16,18H,4,7-14H2,1-3H3 |
| InChIKey | UDODRZPYUHPOLF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |