C14H20BrFN2 — CID 107080540
1-[4-(bromomethyl)-2-fluorophenyl]-N,N-dimethylpiperidin-4-amine (PubChem CID 107080540) has the molecular formula C14H20BrFN2 and a molecular weight of 315.23 g/mol. Its IUPAC name is 1-[4-(bromomethyl)-2-fluorophenyl]-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-[4-(bromomethyl)-2-fluorophenyl]-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 107080540 |
| Molecular Formula | C14H20BrFN2 |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1-[4-(bromomethyl)-2-fluorophenyl]-N,N-dimethylpiperidin-4-amine |
| SMILES | CN(C)C1CCN(c2ccc(CBr)cc2F)CC1 |
| InChI | InChI=1S/C14H20BrFN2/c1-17(2)12-5-7-18(8-6-12)14-4-3-11(10-15)9-13(14)16/h3-4,9,12H,5-8,10H2,1-2H3 |
| InChIKey | TZDHMITVWPENEF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|