C14H17BrFN — CID 107084819
2-[4-(bromomethyl)-2-fluorophenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 107084819) has the molecular formula C14H17BrFN and a molecular weight of 298.20 g/mol. Its IUPAC name is 2-[4-(bromomethyl)-2-fluorophenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | 2-[4-(bromomethyl)-2-fluorophenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 107084819 |
| Molecular Formula | C14H17BrFN |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-[4-(bromomethyl)-2-fluorophenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | Fc1cc(CBr)ccc1N1CC2CCCC2C1 |
| InChI | InChI=1S/C14H17BrFN/c15-7-10-4-5-14(13(16)6-10)17-8-11-2-1-3-12(11)9-17/h4-6,11-12H,1-3,7-9H2 |
| InChIKey | LAFZMEJJGPEXLQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|