C28H39N7O2 — CID 154974166
N-cyclopentyl-N-[5-[(2-oxopyrrolidin-3-yl)methyl]-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidin-4-yl]formamide (PubChem CID 154974166) has the molecular formula C28H39N7O2 and a molecular weight of 505.67 g/mol. Its IUPAC name is N-cyclopentyl-N-[5-[(2-oxopyrrolidin-3-yl)methyl]-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidin-4-yl]formamide.
| Compound Name | N-cyclopentyl-N-[5-[(2-oxopyrrolidin-3-yl)methyl]-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidin-4-yl]formamide |
|---|---|
| PubChem CID | 154974166 |
| Molecular Formula | C28H39N7O2 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | N-cyclopentyl-N-[5-[(2-oxopyrrolidin-3-yl)methyl]-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]pyrimidin-4-yl]formamide |
| SMILES | CC(C)N1CCN(c2ccc(Nc3ncc(CC4CCNC4=O)c(N(C=O)C4CCCC4)n3)cc2)CC1 |
| InChI | InChI=1S/C28H39N7O2/c1-20(2)33-13-15-34(16-14-33)24-9-7-23(8-10-24)31-28-30-18-22(17-21-11-12-29-27(21)37)26(32-28)35(19-36)25-5-3-4-6-25/h7-10,18-21,25H,3-6,11-17H2,1-2H3,(H,29,37)(H,30,31,32) |
| InChIKey | UXLMDTGOPLGQHR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|