C32H42FN5O2 — CID 22124588
1-cyclohexyl-3-fluoro-7-[4-[4-(3-morpholin-4-ylpropyl)piperidin-1-yl]anilino]-1,6-naphthyridin-2-one (PubChem CID 22124588) has the molecular formula C32H42FN5O2 and a molecular weight of 547.72 g/mol. Its IUPAC name is 1-cyclohexyl-3-fluoro-7-[4-[4-(3-morpholin-4-ylpropyl)piperidin-1-yl]anilino]-1,6-naphthyridin-2-one.
| Compound Name | 1-cyclohexyl-3-fluoro-7-[4-[4-(3-morpholin-4-ylpropyl)piperidin-1-yl]anilino]-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 22124588 |
| Molecular Formula | C32H42FN5O2 |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.33 |
| IUPAC Name | 1-cyclohexyl-3-fluoro-7-[4-[4-(3-morpholin-4-ylpropyl)piperidin-1-yl]anilino]-1,6-naphthyridin-2-one |
| SMILES | O=c1c(F)cc2cnc(Nc3ccc(N4CCC(CCCN5CCOCC5)CC4)cc3)cc2n1C1CCCCC1 |
| InChI | InChI=1S/C32H42FN5O2/c33-29-21-25-23-34-31(22-30(25)38(32(29)39)28-6-2-1-3-7-28)35-26-8-10-27(11-9-26)37-15-12-24(13-16-37)5-4-14-36-17-19-40-20-18-36/h8-11,21-24,28H,1-7,12-20H2,(H,34,35) |
| InChIKey | WDLDLFFBFAHYBO-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|