C28H37N5O3 — CID 46701510
1-(4-hydroxycyclohexyl)-3-methyl-7-[[6-(4-morpholin-4-ylbutyl)-3-pyridinyl]amino]-1,6-naphthyridin-2-one (PubChem CID 46701510) has the molecular formula C28H37N5O3 and a molecular weight of 491.64 g/mol. Its IUPAC name is 1-(4-hydroxycyclohexyl)-3-methyl-7-[[6-(4-morpholin-4-ylbutyl)-3-pyridinyl]amino]-1,6-naphthyridin-2-one.
| Compound Name | 1-(4-hydroxycyclohexyl)-3-methyl-7-[[6-(4-morpholin-4-ylbutyl)-3-pyridinyl]amino]-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 46701510 |
| Molecular Formula | C28H37N5O3 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 1-(4-hydroxycyclohexyl)-3-methyl-7-[[6-(4-morpholin-4-ylbutyl)-3-pyridinyl]amino]-1,6-naphthyridin-2-one |
| SMILES | Cc1cc2cnc(Nc3ccc(CCCCN4CCOCC4)nc3)cc2n(C2CCC(O)CC2)c1=O |
| InChI | InChI=1S/C28H37N5O3/c1-20-16-21-18-30-27(17-26(21)33(28(20)35)24-7-9-25(34)10-8-24)31-23-6-5-22(29-19-23)4-2-3-11-32-12-14-36-15-13-32/h5-6,16-19,24-25,34H,2-4,7-15H2,1H3,(H,30,31) |
| InChIKey | VPLVRKGNSYFJTQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|