C24H36N6O2 — CID 72792560
4-[[2-(butylamino)-5-[4-(morpholin-4-ylmethyl)-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 72792560) has the molecular formula C24H36N6O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 4-[[2-(butylamino)-5-[4-(morpholin-4-ylmethyl)-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[2-(butylamino)-5-[4-(morpholin-4-ylmethyl)-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 72792560 |
| Molecular Formula | C24H36N6O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 4-[[2-(butylamino)-5-[4-(morpholin-4-ylmethyl)-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc(-c2cc(CN3CCOCC3)ccn2)c(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C24H36N6O2/c1-2-3-9-26-24-27-16-21(23(29-24)28-19-4-6-20(31)7-5-19)22-15-18(8-10-25-22)17-30-11-13-32-14-12-30/h8,10,15-16,19-20,31H,2-7,9,11-14,17H2,1H3,(H2,26,27,28,29) |
| InChIKey | QBCMBQCPRNSFJE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|