C23H34N6O4S — CID 72792564
4-[[2-(butylamino)-5-(5-morpholin-4-ylsulfonyl-2-pyridinyl)pyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 72792564) has the molecular formula C23H34N6O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is 4-[[2-(butylamino)-5-(5-morpholin-4-ylsulfonyl-2-pyridinyl)pyrimidin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[2-(butylamino)-5-(5-morpholin-4-ylsulfonyl-2-pyridinyl)pyrimidin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 72792564 |
| Molecular Formula | C23H34N6O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 4-[[2-(butylamino)-5-(5-morpholin-4-ylsulfonyl-2-pyridinyl)pyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc(-c2ccc(S(=O)(=O)N3CCOCC3)cn2)c(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C23H34N6O4S/c1-2-3-10-24-23-26-16-20(22(28-23)27-17-4-6-18(30)7-5-17)21-9-8-19(15-25-21)34(31,32)29-11-13-33-14-12-29/h8-9,15-18,30H,2-7,10-14H2,1H3,(H2,24,26,27,28) |
| InChIKey | XEHHSTXCXVSYIR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|