C19H26N6O5S2 — CID 54586040
4-[[4-(4-morpholin-4-ylsulfonylphenyl)pyrimidin-2-yl]amino]piperidine-1-sulfonamide (PubChem CID 54586040) has the molecular formula C19H26N6O5S2 and a molecular weight of 482.59 g/mol. Its IUPAC name is 4-[[4-(4-morpholin-4-ylsulfonylphenyl)pyrimidin-2-yl]amino]piperidine-1-sulfonamide.
| Compound Name | 4-[[4-(4-morpholin-4-ylsulfonylphenyl)pyrimidin-2-yl]amino]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 54586040 |
| Molecular Formula | C19H26N6O5S2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 4-[[4-(4-morpholin-4-ylsulfonylphenyl)pyrimidin-2-yl]amino]piperidine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCC(Nc2nccc(-c3ccc(S(=O)(=O)N4CCOCC4)cc3)n2)CC1 |
| InChI | InChI=1S/C19H26N6O5S2/c20-32(28,29)25-9-6-16(7-10-25)22-19-21-8-5-18(23-19)15-1-3-17(4-2-15)31(26,27)24-11-13-30-14-12-24/h1-5,8,16H,6-7,9-14H2,(H2,20,28,29)(H,21,22,23) |
| InChIKey | OMXIAXJGEYOQEC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |