C31H35FN6O2 — CID 69380095
6-fluoro-2-[4-[4-(3-morpholin-4-ylpropyl)piperidin-1-yl]anilino]-8-phenylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 69380095) has the molecular formula C31H35FN6O2 and a molecular weight of 542.66 g/mol. Its IUPAC name is 6-fluoro-2-[4-[4-(3-morpholin-4-ylpropyl)piperidin-1-yl]anilino]-8-phenylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-fluoro-2-[4-[4-(3-morpholin-4-ylpropyl)piperidin-1-yl]anilino]-8-phenylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 69380095 |
| Molecular Formula | C31H35FN6O2 |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | 6-fluoro-2-[4-[4-(3-morpholin-4-ylpropyl)piperidin-1-yl]anilino]-8-phenylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1c(F)cc2cnc(Nc3ccc(N4CCC(CCCN5CCOCC5)CC4)cc3)nc2n1-c1ccccc1 |
| InChI | InChI=1S/C31H35FN6O2/c32-28-21-24-22-33-31(35-29(24)38(30(28)39)27-6-2-1-3-7-27)34-25-8-10-26(11-9-25)37-15-12-23(13-16-37)5-4-14-36-17-19-40-20-18-36/h1-3,6-11,21-23H,4-5,12-20H2,(H,33,34,35) |
| InChIKey | FJILZKWRFZHVQJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|