C20H22N8 — CID 153407157
N-[4-(4-ethylpiperazin-1-yl)phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine (PubChem CID 153407157) has the molecular formula C20H22N8 and a molecular weight of 374.45 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
|---|---|
| PubChem CID | 153407157 |
| Molecular Formula | C20H22N8 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
| SMILES | CCN1CCN(c2ccc(Nc3ncc4ccc5nncn5c4n3)cc2)CC1 |
| InChI | InChI=1S/C20H22N8/c1-2-26-9-11-27(12-10-26)17-6-4-16(5-7-17)23-20-21-13-15-3-8-18-25-22-14-28(18)19(15)24-20/h3-8,13-14H,2,9-12H2,1H3,(H,21,23,24) |
| InChIKey | YXTXWZXBTZYCNV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|