C29H25N5O2S — CID 59491805
N-[3-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]-3-phenylprop-2-ynamide (PubChem CID 59491805) has the molecular formula C29H25N5O2S and a molecular weight of 507.62 g/mol. Its IUPAC name is N-[3-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]-3-phenylprop-2-ynamide.
| Compound Name | N-[3-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]-3-phenylprop-2-ynamide |
|---|---|
| PubChem CID | 59491805 |
| Molecular Formula | C29H25N5O2S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | N-[3-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]-3-phenylprop-2-ynamide |
| SMILES | O=C(C#Cc1ccccc1)Nc1cccc(Sc2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)c1 |
| InChI | InChI=1S/C29H25N5O2S/c35-27(14-9-22-5-2-1-3-6-22)31-24-7-4-8-26(21-24)37-28-15-16-30-29(33-28)32-23-10-12-25(13-11-23)34-17-19-36-20-18-34/h1-8,10-13,15-16,21H,17-20H2,(H,31,35)(H,30,32,33) |
| InChIKey | CJBBPJXTBXRKNG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|