C20H25N5OS — CID 159848365
methane;4-methyl-5-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]-1,3-thiazol-2-amine (PubChem CID 159848365) has the molecular formula C20H25N5OS and a molecular weight of 383.52 g/mol. Its IUPAC name is methane;4-methyl-5-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]-1,3-thiazol-2-amine.
| Compound Name | methane;4-methyl-5-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 159848365 |
| Molecular Formula | C20H25N5OS |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | methane;4-methyl-5-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]-1,3-thiazol-2-amine |
| SMILES | C.Cc1nc(N)sc1-c1ccnc(Cc2ccc(N3CCOCC3)cc2)n1 |
| InChI | InChI=1S/C19H21N5OS.CH4/c1-13-18(26-19(20)22-13)16-6-7-21-17(23-16)12-14-2-4-15(5-3-14)24-8-10-25-11-9-24;/h2-7H,8-12H2,1H3,(H2,20,22);1H4 |
| InChIKey | NPPISFZEHJTYJT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|