C18H20N4O — CID 168523081
2-cyano-N-[4-(4-pyrrol-1-ylpiperidin-1-yl)phenyl]acetamide (PubChem CID 168523081) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-cyano-N-[4-(4-pyrrol-1-ylpiperidin-1-yl)phenyl]acetamide.
| Compound Name | 2-cyano-N-[4-(4-pyrrol-1-ylpiperidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 168523081 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-cyano-N-[4-(4-pyrrol-1-ylpiperidin-1-yl)phenyl]acetamide |
| SMILES | N#CCC(=O)Nc1ccc(N2CCC(n3cccc3)CC2)cc1 |
| InChI | InChI=1S/C18H20N4O/c19-10-7-18(23)20-15-3-5-16(6-4-15)22-13-8-17(9-14-22)21-11-1-2-12-21/h1-6,11-12,17H,7-9,13-14H2,(H,20,23) |
| InChIKey | UMGRNKOPLRVALQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|