C11H8BrF3N4 — CID 116796985
2-N-[4-bromo-3-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine (PubChem CID 116796985) has the molecular formula C11H8BrF3N4 and a molecular weight of 333.11 g/mol. Its IUPAC name is 2-N-[4-bromo-3-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-bromo-3-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116796985 |
| Molecular Formula | C11H8BrF3N4 |
| Molecular Weight | 333.11 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | 2-N-[4-bromo-3-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Nc1ccnc(Nc2ccc(Br)c(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C11H8BrF3N4/c12-8-2-1-6(5-7(8)11(13,14)15)18-10-17-4-3-9(16)19-10/h1-5H,(H3,16,17,18,19) |
| InChIKey | KJRUPWZJTSJJMU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.11 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |