C14H13ClF3N3 — CID 59137406
N-[4-chloro-3-(trifluoromethyl)phenyl]-4-propan-2-ylpyrimidin-2-amine (PubChem CID 59137406) has the molecular formula C14H13ClF3N3 and a molecular weight of 315.73 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-4-propan-2-ylpyrimidin-2-amine.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-4-propan-2-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 59137406 |
| Molecular Formula | C14H13ClF3N3 |
| Molecular Weight | 315.73 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-4-propan-2-ylpyrimidin-2-amine |
| SMILES | CC(C)c1ccnc(Nc2ccc(Cl)c(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C14H13ClF3N3/c1-8(2)12-5-6-19-13(21-12)20-9-3-4-11(15)10(7-9)14(16,17)18/h3-8H,1-2H3,(H,19,20,21) |
| InChIKey | NCWSTHNANOGUFG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.73 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |