C11H11NO — CID 117277009
2-(4-hydroxy-2,3-dihydro-1H-inden-5-yl)acetonitrile (PubChem CID 117277009) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is 2-(4-hydroxy-2,3-dihydro-1H-inden-5-yl)acetonitrile.
| Compound Name | 2-(4-hydroxy-2,3-dihydro-1H-inden-5-yl)acetonitrile |
|---|---|
| PubChem CID | 117277009 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 2-(4-hydroxy-2,3-dihydro-1H-inden-5-yl)acetonitrile |
| SMILES | N#CCc1ccc2c(c1O)CCC2 |
| InChI | InChI=1S/C11H11NO/c12-7-6-9-5-4-8-2-1-3-10(8)11(9)13/h4-5,13H,1-3,6H2 |
| InChIKey | LTHOTNZFRVSYHR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |