C15H22N2O — CID 117368753
5-(2-piperazin-1-ylethyl)-2,3-dihydro-1H-inden-4-ol (PubChem CID 117368753) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 5-(2-piperazin-1-ylethyl)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 5-(2-piperazin-1-ylethyl)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 117368753 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 5-(2-piperazin-1-ylethyl)-2,3-dihydro-1H-inden-4-ol |
| SMILES | Oc1c(CCN2CCNCC2)ccc2c1CCC2 |
| InChI | InChI=1S/C15H22N2O/c18-15-13(5-4-12-2-1-3-14(12)15)6-9-17-10-7-16-8-11-17/h4-5,16,18H,1-3,6-11H2 |
| InChIKey | PTRJXGVOHODRPY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |