C15H23N3 — CID 115104784
7-(2-piperazin-1-ylethyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 115104784) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 7-(2-piperazin-1-ylethyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-(2-piperazin-1-ylethyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 115104784 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 7-(2-piperazin-1-ylethyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1cc2c(cc1CCN1CCNCC1)CNCC2 |
| InChI | InChI=1S/C15H23N3/c1-2-14-3-5-17-12-15(14)11-13(1)4-8-18-9-6-16-7-10-18/h1-2,11,16-17H,3-10,12H2 |
| InChIKey | VUKNZUTZXSZFKS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |