C12H17NO — CID 117282549
2-(2-aminoethyl)-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 117282549) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-(2-aminoethyl)-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | 2-(2-aminoethyl)-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 117282549 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-(2-aminoethyl)-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | NCCc1ccc2c(c1O)CCCC2 |
| InChI | InChI=1S/C12H17NO/c13-8-7-10-6-5-9-3-1-2-4-11(9)12(10)14/h5-6,14H,1-4,7-8,13H2 |
| InChIKey | MZJBDIMIKPAIMR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |