C11H13NO — CID 84766939
2-(3-hydroxy-2,4,6-trimethylphenyl)acetonitrile (PubChem CID 84766939) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-(3-hydroxy-2,4,6-trimethylphenyl)acetonitrile.
| Compound Name | 2-(3-hydroxy-2,4,6-trimethylphenyl)acetonitrile |
|---|---|
| PubChem CID | 84766939 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-(3-hydroxy-2,4,6-trimethylphenyl)acetonitrile |
| SMILES | Cc1cc(C)c(CC#N)c(C)c1O |
| InChI | InChI=1S/C11H13NO/c1-7-6-8(2)11(13)9(3)10(7)4-5-12/h6,13H,4H2,1-3H3 |
| InChIKey | LZCVVHNEMFVNBZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |