C9H8BrFO3 — CID 117411632
3-(5-bromo-4-fluoro-2,3-dihydroxyphenyl)propanal (PubChem CID 117411632) has the molecular formula C9H8BrFO3 and a molecular weight of 263.06 g/mol. Its IUPAC name is 3-(5-bromo-4-fluoro-2,3-dihydroxyphenyl)propanal.
| Compound Name | 3-(5-bromo-4-fluoro-2,3-dihydroxyphenyl)propanal |
|---|---|
| PubChem CID | 117411632 |
| Molecular Formula | C9H8BrFO3 |
| Molecular Weight | 263.06 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | 3-(5-bromo-4-fluoro-2,3-dihydroxyphenyl)propanal |
| SMILES | O=CCCc1cc(Br)c(F)c(O)c1O |
| InChI | InChI=1S/C9H8BrFO3/c10-6-4-5(2-1-3-12)8(13)9(14)7(6)11/h3-4,13-14H,1-2H2 |
| InChIKey | JHEVTPJQRZTIPP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.06 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|