C9H9FO3 — CID 117279746
3-(3-fluoro-2,4-dihydroxyphenyl)propanal (PubChem CID 117279746) has the molecular formula C9H9FO3 and a molecular weight of 184.17 g/mol. Its IUPAC name is 3-(3-fluoro-2,4-dihydroxyphenyl)propanal.
| Compound Name | 3-(3-fluoro-2,4-dihydroxyphenyl)propanal |
|---|---|
| PubChem CID | 117279746 |
| Molecular Formula | C9H9FO3 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 3-(3-fluoro-2,4-dihydroxyphenyl)propanal |
| SMILES | O=CCCc1ccc(O)c(F)c1O |
| InChI | InChI=1S/C9H9FO3/c10-8-7(12)4-3-6(9(8)13)2-1-5-11/h3-5,12-13H,1-2H2 |
| InChIKey | WZHTWLNWRDXYDR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|