C8H3ClF3N — CID 115111003
2-(3-chloro-2,4,5-trifluorophenyl)acetonitrile (PubChem CID 115111003) has the molecular formula C8H3ClF3N and a molecular weight of 205.57 g/mol. Its IUPAC name is 2-(3-chloro-2,4,5-trifluorophenyl)acetonitrile.
| Compound Name | 2-(3-chloro-2,4,5-trifluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 115111003 |
| Molecular Formula | C8H3ClF3N |
| Molecular Weight | 205.57 g/mol |
| Exact Mass | 204.99 |
| IUPAC Name | 2-(3-chloro-2,4,5-trifluorophenyl)acetonitrile |
| SMILES | N#CCc1cc(F)c(F)c(Cl)c1F |
| InChI | InChI=1S/C8H3ClF3N/c9-6-7(11)4(1-2-13)3-5(10)8(6)12/h3H,1H2 |
| InChIKey | XEBXCXATNFQISH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|