C8H4Cl2FN — CID 84777673
2-(2,5-dichloro-4-fluorophenyl)acetonitrile (PubChem CID 84777673) has the molecular formula C8H4Cl2FN and a molecular weight of 204.03 g/mol. Its IUPAC name is 2-(2,5-dichloro-4-fluorophenyl)acetonitrile.
| Compound Name | 2-(2,5-dichloro-4-fluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 84777673 |
| Molecular Formula | C8H4Cl2FN |
| Molecular Weight | 204.03 g/mol |
| Exact Mass | 202.97 |
| IUPAC Name | 2-(2,5-dichloro-4-fluorophenyl)acetonitrile |
| SMILES | N#CCc1cc(Cl)c(F)cc1Cl |
| InChI | InChI=1S/C8H4Cl2FN/c9-6-4-8(11)7(10)3-5(6)1-2-12/h3-4H,1H2 |
| InChIKey | OAIQPZBJRLNXQT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.03 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|