C17H5F7KN5O2 — CID 159324747
potassium;ethyl 2-cyano-2-(2-cyano-3,5,6-trifluoro-4-pyridinyl)acetate;3,4,5,6-tetrafluoropyridine-2-carbonitrile (PubChem CID 159324747) has the molecular formula C17H5F7KN5O2 and a molecular weight of 483.34 g/mol. Its IUPAC name is potassium;ethyl 2-cyano-2-(2-cyano-3,5,6-trifluoro-4-pyridinyl)acetate;3,4,5,6-tetrafluoropyridine-2-carbonitrile.
| Compound Name | potassium;ethyl 2-cyano-2-(2-cyano-3,5,6-trifluoro-4-pyridinyl)acetate;3,4,5,6-tetrafluoropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 159324747 |
| Molecular Formula | C17H5F7KN5O2 |
| Molecular Weight | 483.34 g/mol |
| Exact Mass | 483.00 |
| IUPAC Name | potassium;ethyl 2-cyano-2-(2-cyano-3,5,6-trifluoro-4-pyridinyl)acetate;3,4,5,6-tetrafluoropyridine-2-carbonitrile |
| SMILES | CCOC(=O)[C-](C#N)c1c(F)c(F)nc(C#N)c1F.N#Cc1nc(F)c(F)c(F)c1F.[K+] |
| InChI | InChI=1S/C11H5F3N3O2.C6F4N2.K/c1-2-19-11(18)5(3-15)7-8(12)6(4-16)17-10(14)9(7)13;7-3-2(1-11)12-6(10)5(9)4(3)8;/h2H2,1H3;;/q-1;;+1 |
| InChIKey | WVBIVNRIDJVQBV-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 123.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.34 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|