C10H8F3N3O3 — CID 133096574
ethyl 5-amino-6-cyano-2-(trifluoromethoxy)pyridine-3-carboxylate (PubChem CID 133096574) has the molecular formula C10H8F3N3O3 and a molecular weight of 275.19 g/mol. Its IUPAC name is ethyl 5-amino-6-cyano-2-(trifluoromethoxy)pyridine-3-carboxylate.
| Compound Name | ethyl 5-amino-6-cyano-2-(trifluoromethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133096574 |
| Molecular Formula | C10H8F3N3O3 |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | ethyl 5-amino-6-cyano-2-(trifluoromethoxy)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(N)c(C#N)nc1OC(F)(F)F |
| InChI | InChI=1S/C10H8F3N3O3/c1-2-18-9(17)5-3-6(15)7(4-14)16-8(5)19-10(11,12)13/h3H,2,15H2,1H3 |
| InChIKey | KVCLAFQIVTURRB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |