C11H8BrF6NO3 — CID 134682872
ethyl 5-(bromomethyl)-2-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 134682872) has the molecular formula C11H8BrF6NO3 and a molecular weight of 396.08 g/mol. Its IUPAC name is ethyl 5-(bromomethyl)-2-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | ethyl 5-(bromomethyl)-2-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134682872 |
| Molecular Formula | C11H8BrF6NO3 |
| Molecular Weight | 396.08 g/mol |
| Exact Mass | 394.96 |
| IUPAC Name | ethyl 5-(bromomethyl)-2-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CBr)c(C(F)(F)F)nc1OC(F)(F)F |
| InChI | InChI=1S/C11H8BrF6NO3/c1-2-21-9(20)6-3-5(4-12)7(10(13,14)15)19-8(6)22-11(16,17)18/h3H,2,4H2,1H3 |
| InChIKey | MCVQCSGIYPHEAQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.08 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|