C10H8BrF3INO3 — CID 134665879
ethyl 2-(bromomethyl)-6-iodo-5-(trifluoromethoxy)pyridine-3-carboxylate (PubChem CID 134665879) has the molecular formula C10H8BrF3INO3 and a molecular weight of 453.98 g/mol. Its IUPAC name is ethyl 2-(bromomethyl)-6-iodo-5-(trifluoromethoxy)pyridine-3-carboxylate.
| Compound Name | ethyl 2-(bromomethyl)-6-iodo-5-(trifluoromethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134665879 |
| Molecular Formula | C10H8BrF3INO3 |
| Molecular Weight | 453.98 g/mol |
| Exact Mass | 452.87 |
| IUPAC Name | ethyl 2-(bromomethyl)-6-iodo-5-(trifluoromethoxy)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(OC(F)(F)F)c(I)nc1CBr |
| InChI | InChI=1S/C10H8BrF3INO3/c1-2-18-9(17)5-3-7(19-10(12,13)14)8(15)16-6(5)4-11/h3H,2,4H2,1H3 |
| InChIKey | BNLOUIZNLAHDCF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.98 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|