C15H18NO7P — CID 175181798
(3-amino-4,5-dimethoxy-2-methyl-6-phenoxyphenyl) dihydrogen phosphate (PubChem CID 175181798) has the molecular formula C15H18NO7P and a molecular weight of 355.28 g/mol. Its IUPAC name is (3-amino-4,5-dimethoxy-2-methyl-6-phenoxyphenyl) dihydrogen phosphate.
| Compound Name | (3-amino-4,5-dimethoxy-2-methyl-6-phenoxyphenyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 175181798 |
| Molecular Formula | C15H18NO7P |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (3-amino-4,5-dimethoxy-2-methyl-6-phenoxyphenyl) dihydrogen phosphate |
| SMILES | COc1c(N)c(C)c(OP(=O)(O)O)c(Oc2ccccc2)c1OC |
| InChI | InChI=1S/C15H18NO7P/c1-9-11(16)13(20-2)14(21-3)15(12(9)23-24(17,18)19)22-10-7-5-4-6-8-10/h4-8H,16H2,1-3H3,(H2,17,18,19) |
| InChIKey | DOFJDWFFTSPICB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|