C23H22O5P- — CID 141016293
phenyl-(2,3,5-trimethoxy-6-methyl-4-phenoxyphenyl)phosphanylidenemethanolate (PubChem CID 141016293) has the molecular formula C23H22O5P- and a molecular weight of 409.40 g/mol. Its IUPAC name is phenyl-(2,3,5-trimethoxy-6-methyl-4-phenoxyphenyl)phosphanylidenemethanolate.
| Compound Name | phenyl-(2,3,5-trimethoxy-6-methyl-4-phenoxyphenyl)phosphanylidenemethanolate |
|---|---|
| PubChem CID | 141016293 |
| Molecular Formula | C23H22O5P- |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | phenyl-(2,3,5-trimethoxy-6-methyl-4-phenoxyphenyl)phosphanylidenemethanolate |
| SMILES | COc1c(C)c(/P=C(\[O-])c2ccccc2)c(OC)c(OC)c1Oc1ccccc1 |
| InChI | InChI=1S/C23H23O5P/c1-15-18(25-2)20(28-17-13-9-6-10-14-17)19(26-3)21(27-4)22(15)29-23(24)16-11-7-5-8-12-16/h5-14,24H,1-4H3/p-1 |
| InChIKey | ZBNWYWXUSYHERZ-UHFFFAOYSA-M |
| XLogP | 3.92 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|