C20H24O5P- — CID 141016336
phenyl-[2,3,5-trimethoxy-4-(2-methylpropoxy)phenyl]phosphanylidenemethanolate (PubChem CID 141016336) has the molecular formula C20H24O5P- and a molecular weight of 375.38 g/mol. Its IUPAC name is phenyl-[2,3,5-trimethoxy-4-(2-methylpropoxy)phenyl]phosphanylidenemethanolate.
| Compound Name | phenyl-[2,3,5-trimethoxy-4-(2-methylpropoxy)phenyl]phosphanylidenemethanolate |
|---|---|
| PubChem CID | 141016336 |
| Molecular Formula | C20H24O5P- |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | phenyl-[2,3,5-trimethoxy-4-(2-methylpropoxy)phenyl]phosphanylidenemethanolate |
| SMILES | COc1cc(/P=C(\[O-])c2ccccc2)c(OC)c(OC)c1OCC(C)C |
| InChI | InChI=1S/C20H25O5P/c1-13(2)12-25-17-15(22-3)11-16(18(23-4)19(17)24-5)26-20(21)14-9-7-6-8-10-14/h6-11,13,21H,12H2,1-5H3/p-1 |
| InChIKey | BHGCANQFKVKNFQ-UHFFFAOYSA-M |
| XLogP | 2.86 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|