C12H19BO5 — CID 67467385
[3,4-dimethoxy-2-(2-methylpropoxy)phenyl]boronic acid (PubChem CID 67467385) has the molecular formula C12H19BO5 and a molecular weight of 254.09 g/mol. Its IUPAC name is [3,4-dimethoxy-2-(2-methylpropoxy)phenyl]boronic acid.
| Compound Name | [3,4-dimethoxy-2-(2-methylpropoxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 67467385 |
| Molecular Formula | C12H19BO5 |
| Molecular Weight | 254.09 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | [3,4-dimethoxy-2-(2-methylpropoxy)phenyl]boronic acid |
| SMILES | COc1ccc(B(O)O)c(OCC(C)C)c1OC |
| InChI | InChI=1S/C12H19BO5/c1-8(2)7-18-11-9(13(14)15)5-6-10(16-3)12(11)17-4/h5-6,8,14-15H,7H2,1-4H3 |
| InChIKey | KZVXHCWGHYBVRP-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.09 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|