C15H12F4O — CID 102261730
1-(3,4-dimethylphenyl)-2,3,5,6-tetrafluoro-4-methoxybenzene (PubChem CID 102261730) has the molecular formula C15H12F4O and a molecular weight of 284.25 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2,3,5,6-tetrafluoro-4-methoxybenzene.
| Compound Name | 1-(3,4-dimethylphenyl)-2,3,5,6-tetrafluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 102261730 |
| Molecular Formula | C15H12F4O |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2,3,5,6-tetrafluoro-4-methoxybenzene |
| SMILES | COc1c(F)c(F)c(-c2ccc(C)c(C)c2)c(F)c1F |
| InChI | InChI=1S/C15H12F4O/c1-7-4-5-9(6-8(7)2)10-11(16)13(18)15(20-3)14(19)12(10)17/h4-6H,1-3H3 |
| InChIKey | LIAHQTGFNWLVRL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|