C32H28F6O2 — CID 89142850
1-methoxy-3-[3-methoxy-2,4,6-trimethyl-5-(3,4,5-trifluorophenyl)phenyl]-2,4,6-trimethyl-5-(3,4,5-trifluorophenyl)benzene (PubChem CID 89142850) has the molecular formula C32H28F6O2 and a molecular weight of 558.56 g/mol. Its IUPAC name is 1-methoxy-3-[3-methoxy-2,4,6-trimethyl-5-(3,4,5-trifluorophenyl)phenyl]-2,4,6-trimethyl-5-(3,4,5-trifluorophenyl)benzene.
| Compound Name | 1-methoxy-3-[3-methoxy-2,4,6-trimethyl-5-(3,4,5-trifluorophenyl)phenyl]-2,4,6-trimethyl-5-(3,4,5-trifluorophenyl)benzene |
|---|---|
| PubChem CID | 89142850 |
| Molecular Formula | C32H28F6O2 |
| Molecular Weight | 558.56 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 1-methoxy-3-[3-methoxy-2,4,6-trimethyl-5-(3,4,5-trifluorophenyl)phenyl]-2,4,6-trimethyl-5-(3,4,5-trifluorophenyl)benzene |
| SMILES | COc1c(C)c(-c2cc(F)c(F)c(F)c2)c(C)c(-c2c(C)c(OC)c(C)c(-c3cc(F)c(F)c(F)c3)c2C)c1C |
| InChI | InChI=1S/C32H28F6O2/c1-13-25(19-9-21(33)29(37)22(34)10-19)15(3)31(39-7)17(5)27(13)28-14(2)26(16(4)32(40-8)18(28)6)20-11-23(35)30(38)24(36)12-20/h9-12H,1-8H3 |
| InChIKey | TWUUSLMZQDXKDE-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.56 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|