C13H16Cl2O — CID 146007752
2,2-dichloro-1-(2,3,4,5,6-pentamethylphenyl)ethanone (PubChem CID 146007752) has the molecular formula C13H16Cl2O and a molecular weight of 259.18 g/mol. Its IUPAC name is 2,2-dichloro-1-(2,3,4,5,6-pentamethylphenyl)ethanone.
| Compound Name | 2,2-dichloro-1-(2,3,4,5,6-pentamethylphenyl)ethanone |
|---|---|
| PubChem CID | 146007752 |
| Molecular Formula | C13H16Cl2O |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2,2-dichloro-1-(2,3,4,5,6-pentamethylphenyl)ethanone |
| SMILES | Cc1c(C)c(C)c(C(=O)C(Cl)Cl)c(C)c1C |
| InChI | InChI=1S/C13H16Cl2O/c1-6-7(2)9(4)11(10(5)8(6)3)12(16)13(14)15/h13H,1-5H3 |
| InChIKey | RPOTZPSFOXTFQM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|