C14H17ClO3 — CID 82487737
methyl 2-chloro-3-oxo-3-(2,3,5,6-tetramethylphenyl)propanoate (PubChem CID 82487737) has the molecular formula C14H17ClO3 and a molecular weight of 268.74 g/mol. Its IUPAC name is methyl 2-chloro-3-oxo-3-(2,3,5,6-tetramethylphenyl)propanoate.
| Compound Name | methyl 2-chloro-3-oxo-3-(2,3,5,6-tetramethylphenyl)propanoate |
|---|---|
| PubChem CID | 82487737 |
| Molecular Formula | C14H17ClO3 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | methyl 2-chloro-3-oxo-3-(2,3,5,6-tetramethylphenyl)propanoate |
| SMILES | COC(=O)C(Cl)C(=O)c1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C14H17ClO3/c1-7-6-8(2)10(4)11(9(7)3)13(16)12(15)14(17)18-5/h6,12H,1-5H3 |
| InChIKey | NQBPDLKYOWRIAC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|