C14H18O3 — CID 116918196
2-methyl-3-oxo-3-(2,3,5,6-tetramethylphenyl)propanoic acid (PubChem CID 116918196) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-(2,3,5,6-tetramethylphenyl)propanoic acid.
| Compound Name | 2-methyl-3-oxo-3-(2,3,5,6-tetramethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 116918196 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2-methyl-3-oxo-3-(2,3,5,6-tetramethylphenyl)propanoic acid |
| SMILES | Cc1cc(C)c(C)c(C(=O)C(C)C(=O)O)c1C |
| InChI | InChI=1S/C14H18O3/c1-7-6-8(2)10(4)12(9(7)3)13(15)11(5)14(16)17/h6,11H,1-5H3,(H,16,17) |
| InChIKey | AINZMEOYRQZALJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|