3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid

C16H22O3 — CID 24727227

IUPAC3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid
SMILESCc1cc(C)c(C)c(C(=O)CC(C)CC(=O)O)c1C
InChIInChI=1S/C16H22O3/c1-9(7-15(18)19)6-14(17)16-12(4)10(2)8-11(3)13(16)5/h8-9H,6-7H2,1-5H3,(H,18,19)
InChIKeyAFWWWMYRYICETD-UHFFFAOYSA-N
MW262.35 g/mol
LogP3.60
Rot. Bonds5

About 3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid

3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid (PubChem CID 24727227) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid.

Molecular Properties

Compound Name3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid
PubChem CID24727227
Molecular FormulaC16H22O3
Molecular Weight262.35 g/mol
Exact Mass262.16
IUPAC Name3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid
SMILESCc1cc(C)c(C)c(C(=O)CC(C)CC(=O)O)c1C
InChIInChI=1S/C16H22O3/c1-9(7-15(18)19)6-14(17)16-12(4)10(2)8-11(3)13(16)5/h8-9H,6-7H2,1-5H3,(H,18,19)
InChIKeyAFWWWMYRYICETD-UHFFFAOYSA-N
XLogP3.60
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.35
LogP ≤ 53.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid?
The IUPAC name of 3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid (CID 24727227) is 3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid.
What is the SMILES notation for 3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid?
The canonical SMILES for 3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid is Cc1cc(C)c(C)c(C(=O)CC(C)CC(=O)O)c1C.
What is the InChIKey of 3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid?
The InChIKey is AFWWWMYRYICETD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O3/c1-9(7-15(18)19)6-14(17)16-12(4)10(2)8-11(3)13(16)5/h8-9H,6-7H2,1-5H3,(H,18,19).
What are the key properties of 3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid?
3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid has a molecular weight of 262.35 g/mol, XLogP of 3.60, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-oxo-5-(2,3,5,6-tetramethylphenyl)pentanoic acid is sourced from PubChem (CID 24727227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).