C13H16O3 — CID 116918219
2-methyl-3-oxo-3-(2,4,5-trimethylphenyl)propanoic acid (PubChem CID 116918219) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-(2,4,5-trimethylphenyl)propanoic acid.
| Compound Name | 2-methyl-3-oxo-3-(2,4,5-trimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 116918219 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 2-methyl-3-oxo-3-(2,4,5-trimethylphenyl)propanoic acid |
| SMILES | Cc1cc(C)c(C(=O)C(C)C(=O)O)cc1C |
| InChI | InChI=1S/C13H16O3/c1-7-5-9(3)11(6-8(7)2)12(14)10(4)13(15)16/h5-6,10H,1-4H3,(H,15,16) |
| InChIKey | QGTGRDLUTDRTJO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|