C7H6Cl2O2 — CID 116827193
2,2-dichloro-1-(5-methylfuran-2-yl)ethanone (PubChem CID 116827193) has the molecular formula C7H6Cl2O2 and a molecular weight of 193.03 g/mol. Its IUPAC name is 2,2-dichloro-1-(5-methylfuran-2-yl)ethanone.
| Compound Name | 2,2-dichloro-1-(5-methylfuran-2-yl)ethanone |
|---|---|
| PubChem CID | 116827193 |
| Molecular Formula | C7H6Cl2O2 |
| Molecular Weight | 193.03 g/mol |
| Exact Mass | 191.97 |
| IUPAC Name | 2,2-dichloro-1-(5-methylfuran-2-yl)ethanone |
| SMILES | Cc1ccc(C(=O)C(Cl)Cl)o1 |
| InChI | InChI=1S/C7H6Cl2O2/c1-4-2-3-5(11-4)6(10)7(8)9/h2-3,7H,1H3 |
| InChIKey | MZSOAUBENATPAA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.03 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|