C10H9Cl3O — CID 130966551
2,2-dichloro-1-(4-chloro-3,5-dimethylphenyl)ethanone (PubChem CID 130966551) has the molecular formula C10H9Cl3O and a molecular weight of 251.54 g/mol. Its IUPAC name is 2,2-dichloro-1-(4-chloro-3,5-dimethylphenyl)ethanone.
| Compound Name | 2,2-dichloro-1-(4-chloro-3,5-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 130966551 |
| Molecular Formula | C10H9Cl3O |
| Molecular Weight | 251.54 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | 2,2-dichloro-1-(4-chloro-3,5-dimethylphenyl)ethanone |
| SMILES | Cc1cc(C(=O)C(Cl)Cl)cc(C)c1Cl |
| InChI | InChI=1S/C10H9Cl3O/c1-5-3-7(9(14)10(12)13)4-6(2)8(5)11/h3-4,10H,1-2H3 |
| InChIKey | UZWRXFZLKAQYQN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|