C12H15ClO — CID 91656871
1-(4-chloro-3,5-dimethylphenyl)butan-1-one (PubChem CID 91656871) has the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. Its IUPAC name is 1-(4-chloro-3,5-dimethylphenyl)butan-1-one.
| Compound Name | 1-(4-chloro-3,5-dimethylphenyl)butan-1-one |
|---|---|
| PubChem CID | 91656871 |
| Molecular Formula | C12H15ClO |
| Molecular Weight | 210.70 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-(4-chloro-3,5-dimethylphenyl)butan-1-one |
| SMILES | CCCC(=O)c1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C12H15ClO/c1-4-5-11(14)10-6-8(2)12(13)9(3)7-10/h6-7H,4-5H2,1-3H3 |
| InChIKey | AIIZOGFTMRTGGO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.70 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |