C10H8Cl4O — CID 146005570
2,2,2-trichloro-1-(4-chloro-3,5-dimethylphenyl)ethanone (PubChem CID 146005570) has the molecular formula C10H8Cl4O and a molecular weight of 285.99 g/mol. Its IUPAC name is 2,2,2-trichloro-1-(4-chloro-3,5-dimethylphenyl)ethanone.
| Compound Name | 2,2,2-trichloro-1-(4-chloro-3,5-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 146005570 |
| Molecular Formula | C10H8Cl4O |
| Molecular Weight | 285.99 g/mol |
| Exact Mass | 283.93 |
| IUPAC Name | 2,2,2-trichloro-1-(4-chloro-3,5-dimethylphenyl)ethanone |
| SMILES | Cc1cc(C(=O)C(Cl)(Cl)Cl)cc(C)c1Cl |
| InChI | InChI=1S/C10H8Cl4O/c1-5-3-7(4-6(2)8(5)11)9(15)10(12,13)14/h3-4H,1-2H3 |
| InChIKey | QOBATFWEHKDLHF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.99 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|