C8H7Cl2NO — CID 121228378
3,4-dichloro-5-methylbenzamide (PubChem CID 121228378) has the molecular formula C8H7Cl2NO and a molecular weight of 204.06 g/mol. Its IUPAC name is 3,4-dichloro-5-methylbenzamide.
| Compound Name | 3,4-dichloro-5-methylbenzamide |
|---|---|
| PubChem CID | 121228378 |
| Molecular Formula | C8H7Cl2NO |
| Molecular Weight | 204.06 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | 3,4-dichloro-5-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)cc(Cl)c1Cl |
| InChI | InChI=1S/C8H7Cl2NO/c1-4-2-5(8(11)12)3-6(9)7(4)10/h2-3H,1H3,(H2,11,12) |
| InChIKey | MNCSONARRRNYRT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.06 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |