About 5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride
5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride (PubChem CID 65368231) has the molecular formula C9H10ClNO3S
and a molecular weight of 247.70 g/mol. Its IUPAC name is 5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride |
| PubChem CID | 65368231 |
| Molecular Formula | C9H10ClNO3S |
| Molecular Weight | 247.70 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride |
| SMILES | Cc1cc(C(N)=O)cc(S(=O)(=O)Cl)c1C |
| InChI | InChI=1S/C9H10ClNO3S/c1-5-3-7(9(11)12)4-8(6(5)2)15(10,13)14/h3-4H,1-2H3,(H2,11,12) |
| InChIKey | FNZOHNQRJVUDKZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.70 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride?
The IUPAC name of 5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride (CID 65368231) is 5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride.
What is the SMILES notation for 5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride?
The canonical SMILES for 5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride is Cc1cc(C(N)=O)cc(S(=O)(=O)Cl)c1C.
What is the InChIKey of 5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride?
The InChIKey is FNZOHNQRJVUDKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO3S/c1-5-3-7(9(11)12)4-8(6(5)2)15(10,13)14/h3-4H,1-2H3,(H2,11,12).
What are the key properties of 5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride?
5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride has a molecular weight of 247.70 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride is sourced from PubChem (CID 65368231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).