C9H10ClNO3S — CID 65368231
5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride (PubChem CID 65368231) has the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. Its IUPAC name is 5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride.
| Compound Name | 5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 65368231 |
| Molecular Formula | C9H10ClNO3S |
| Molecular Weight | 247.70 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 5-carbamoyl-2,3-dimethylbenzenesulfonyl chloride |
| SMILES | Cc1cc(C(N)=O)cc(S(=O)(=O)Cl)c1C |
| InChI | InChI=1S/C9H10ClNO3S/c1-5-3-7(9(11)12)4-8(6(5)2)15(10,13)14/h3-4H,1-2H3,(H2,11,12) |
| InChIKey | FNZOHNQRJVUDKZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.70 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |